| Identification | |
| Name: | 2-Fluorobenzoyl chloride |
| Synonyms: | o-fluorobenzenecarbonyl chloride ; o-Fluorobenzoyl chloride |
| CAS: | 393-52-2 |
| EINECS: | 206-887-2 |
| Molecular Formula: | C7H4ClFO |
| Molecular Weight: | 158.56 |
| InChI: | InChI=1/C7H4ClFO/c8-7(10)5-3-1-2-4-6(5)9/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 250kgs |
| Density: | 1.304 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5355-1.5375 |
| Water Solubility: | Decomposes |
| Solubility: | Decomposes |
| Appearance: | clear to light yellow liquid |
| Packinggroup: | II |
| HS Code: | 29163900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Lachrymatory |
| Color: | Liquid |
| Usage: | Chemical intermediate for flunitrazepam, a hypnotic drug. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
