| Identification | |
| Name: | 4-Fluorobenzoyl chloride |
| Synonyms: | 4-Fluorobenozyl Chloride; p-Fluorobenzoyl chloride |
| CAS: | 403-43-0 |
| EINECS: | 206-961-4 |
| Molecular Formula: | C7H4ClFO |
| Molecular Weight: | 158.56 |
| InChI: | InChI=1/C7H4ClFO/c8-7(10)5-1-3-6(9)4-2-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 250kgs |
| Density: | 1.34 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5299-1.5319 |
| Water Solubility: | Decomposes |
| Solubility: | Decomposes |
| Appearance: | clear to light yellow liquid |
| Specification: | clear colourless to light yellow liquid Safety Statements:26-36/37/39-45-28A-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 27:Take off immediately all contaminated clothing |
| Packinggroup: | II |
| HS Code: | 29163900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
