| Identification | |
| Name: | Phenol,4-amino-2-chloro- |
| Synonyms: | (3-Chloro-4-hydroxyphenyl)amine;2-Chloro-4-aminophenol;2-Chloro-p-aminophenol;4-Amino-2-chlorophenol;m-Chloro-p-hydroxyaniline; |
| CAS: | 3964-52-1 |
| Molecular Formula: | C6H6ClNO |
| Molecular Weight: | 143.57094 |
| InChI: | InChI=1S/C6H6ClNO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 130.8°C |
| Boiling Point: | 292.7°Cat760mmHg |
| Density: | 1.406g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.65 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed, inhaled or absorbed through the skin. Irritant.Skin or eye contact may lead to burns. |
| Solubility: |
|
| Appearance: | solid |
| Flash Point: | 130.8°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
