| Identification | |
| Name: | 2-Propanol-d (9CI) |
| Synonyms: | Isopropylalcohol-d (6CI,7CI,8CI); 2-Propanol-O-d1; Isopropanol-d; i-Propanol-d |
| CAS: | 3979-51-9 |
| EINECS: | 223-616-3 |
| Molecular Formula: | C3H7 D O |
| Molecular Weight: | 60.095 |
| InChI: | InChI=1/C3H8O/c1-3(2)4/h3-4H,1-2H3/i4D |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1219 3/PG 2 |
| Melting Point: | -90 ºC(lit.) |
| Flash Point: | 11.7 ºC |
| Boiling Point: | 73 ºC at 760 mmHg |
| Density: | 0.791 g/cm3 |
| Refractive index: | n20/D 1.3752(lit.) |
| Solubility: | Miscible with chloroform; insoluble in salt soln SOL IN BENZENE MISCIBLE WITH MOST ORGANIC SOLVENTS In water: 1.00X10+6 @ 25 deg C > 10% in alcohol > 10% in ether > 10% in acetone |
| Flash Point: | 11.7 ºC |
| Color: | Colorless liquid. |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xi: Irritant
|
 |
|
