| Identification | |
| Name: | Acetamide,N-(4'-fluoro[1,1'-biphenyl]-4-yl)- |
| Synonyms: | Acetanilide,4'-(p-fluorophenyl)- (6CI,7CI,8CI); 4-Acetylamino-4'-fluorobiphenyl;N-(4'-Fluoro-4-biphenylyl)acetamide; N-4-(4'-Fluorobiphenyl)acetamide; NSC73090 |
| CAS: | 398-32-3 |
| EINECS: | 206-912-7 |
| Molecular Formula: | C14H12 F N O |
| Molecular Weight: | 229.27 |
| InChI: | InChI=1/C14H12FNO/c1-10(17)16-14-8-4-12(5-9-14)11-2-6-13(15)7-3-11/h2-9H,1H3,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 205-207 °C |
| Flash Point: | 205.5°C |
| Boiling Point: | 416.1°Cat760mmHg |
| Density: | 1.193g/cm3 |
| Refractive index: | 1.593 |
| Specification: |
4'-Fluoro-4-biphenylacetamide (CAS NO.398-32-3) can be called Acetamide, N-(4'-fluoro(1,1'-biphenyl)-4-yl)- (9CI) ; Acetanilide, 4'-(p-fluorophenyl)- ; N-(4'-Fluoro(1,1'-biphenyl)-4-yl)acetamide ; 4'-(p-Fluorophenyl)acetanilide ; 4'-Fluoro-4-acetylaminobiphenyl ; 4-12-00-03268 (Beilstein Handbook Reference) ; Acetamide, N-(4'-fluoro-4-biphenylyl)- ; N-(4'-Fluoro-4-biphenylyl)acetamide ; N-4-(4'-Fluoro)biphenylacetamide and so on. 4'-Fluoro-4-biphenylacetamide (CAS NO.398-32-3) is Beige to brown crystalline powder. |
| Flash Point: | 205.5°C |
| Safety Data | |
 |
|
