Identification |
Name: | Acetamide,N-(3'-fluoro[1,1'-biphenyl]-4-yl)- |
Synonyms: | Acetanilide,4'-(m-fluorophenyl)- (7CI,8CI) |
CAS: | 725-06-4 |
Molecular Formula: | C14H12 F N O |
Molecular Weight: | 229.27 |
InChI: | InChI=1/C14H12FNO/c1-10(17)16-14-7-5-11(6-8-14)12-3-2-4-13(15)9-12/h2-9H,1H3,(H,16,17) |
Molecular Structure: |
|
Properties |
Flash Point: | 207.8°C |
Boiling Point: | 420°C at 760 mmHg |
Density: | 1.193g/cm3 |
Refractive index: | 1.593 |
Specification: |
4'-(m-Fluorophenyl)acetanilide , its cas register number is 725-06-4. It also can be called Acetanilide, 4'-(m-fluorophenyl)- ; and 3'-Fluoro-4-acetylaminobiphenyl .
|
Flash Point: | 207.8°C |
Safety Data |
|
|