Identification |
Name: | 2-Propenoic acid, 2-methyl-, butyl ester, polymer with 2-(3-oxazolidinyl)ethyl 2-methyl-2-propenoate |
Synonyms: | 2-Propenoic acid, 2-methyl-, butyl ester, polymer with 2-(3-oxazolidinyl)ethyl 2-methyl-2-propenoate |
CAS: | 39935-66-5 |
Molecular Formula: | C17H29NO5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C9H15NO3.C8H14O2/c1-8(2)9(11)13-6-4-10-3-5-12-7-10;1-4-5-6-10-8(9)7(2)3/h1,3-7H2,2H3;2,4-6H2,1,3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 119.8°C |
Boiling Point: | 274.5°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 119.8°C |
Safety Data |
|
 |