| Identification | |
| Name: | 2-Propenoic acid, 2-methyl-, butyl ester, polymer with ethyl 2-methyl-2-propenoate and 2-propenoic acid |
| Synonyms: | 2-Propenoic acid, 2-methyl-, butyl ester, polymer with ethyl 2-methyl-2-propenoate and 2-propenoic acid |
| CAS: | 50861-78-4 |
| Molecular Formula: | C17H28O6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C8H14O2.C6H10O2.C3H4O2/c1-4-5-6-10-8(9)7(2)3;1-4-8-6(7)5(2)3;1-2-3(4)5/h2,4-6H2,1,3H3;2,4H2,1,3H3;2H,1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 50.6°C |
| Boiling Point: | 160°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 50.6°C |
| Safety Data | |
 |
|
