| Identification | |
| Name: | Oxirane,2-[(1-methylethoxy)methyl]- |
| CAS: | 4016-14-2 |
| EINECS: | 223-672-9 |
| Molecular Formula: | C6H12 O2 |
| Molecular Weight: | 116.18 |
| InChI: | InChI=1/C6H12O2/c1-5(2)7-3-6-4-8-6/h5-6H,3-4H2,1-2H3/t6-/m1/s1 |
| Molecular Structure: | ![(C6H12O2) Oxirane,[(1-methylethoxy)methyl]- (9CI); Propane, 1,2-epoxy-3-isopropoxy-(6CI,7CI,8CI); (Isopropoxym...](https://img1.guidechem.com/chem/e/dict/164/4016-14-2.jpg) |
| Properties | |
| Transport: | UN 3271 3/PG 3 |
| Flash Point: | 33.3 ºC |
| Boiling Point: | 131ºC at 760 mmHg |
| Density: | 0.955 g/cm3 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.410(lit.) |
| Water Solubility: | Stability Stable. Flammable. Incompatible with strong oxidizing agents. Toxicology Skin irritant. May act as a sensitizer. Toxicity data (The meaning of any tox |
| Solubility: |
|
| Appearance: | colourless liquid |
| Report: |
Glycol ether compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Flash Point: | 33.3 ºC |
| Storage Temperature: | -20°C |
| Color: | MOBILE, COLORLESS LIQUID Colorless liquid. |
| Safety Data | |
| Hazard Symbols |
. TLV.gif)
Flammable liquid with flash p 92F (33.33C). TLV: TWA 50
|
 |
|
