Identification |
Name: | Oxirane,2-[[4-[[2-(1-methylethoxy)ethoxy]methyl]phenoxy]methyl]- |
Synonyms: | Oxirane,[[4-[[2-(1-methylethoxy)ethoxy]methyl]phenoxy]methyl]- (9CI);2-[(4-{[2-(propan-2-yloxy)ethoxy]methyl}phenoxy)methyl]oxirane;oxirane, 2-[[4-[[2-(1-methylethoxy)ethoxy]methyl]phenoxy]methyl]-;[[4-[[2-(1-Methylethoxy)ethoxy]methyl]phenoxy]methyl]oxirane; |
CAS: | 66722-57-4 |
Molecular Formula: | C15H22O4 |
Molecular Weight: | 266.33 |
InChI: | InChI=1/C15H22O4/c1-12(2)17-8-7-16-9-13-3-5-14(6-4-13)18-10-15-11-19-15/h3-6,12,15H,7-11H2,1-2H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 118.2°C |
Boiling Point: | 362.6°C at 760 mmHg |
Density: | 1.084g/cm3 |
Refractive index: | 1.508 |
Appearance: | pale yellow oil |
Flash Point: | 118.2°C |
Usage: | An intermediate for the synthesis of Bisoprolol |
Safety Data |
|
|