| Identification | |
| Name: | 3-Fluorophenyl isocyanate |
| Synonyms: | 3-Flurophenyl isocyanate |
| CAS: | 404-71-7 |
| EINECS: | 206-966-1 |
| Molecular Formula: | C7H4FNO |
| Molecular Weight: | 137.11 |
| InChI: | InChI=1/C7H4FNO/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3080 6.1/PG 2 |
| Density: | 1.201 |
| Refractive index: | n20/D 1.514(lit.) |
| Appearance: | clear colorless liquid |
| Specification: | clear colorless liquid Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Storage Temperature: | 0-6°C |
| Sensitive: | Moisture Sensitive/Lachrymatory |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
