| Identification |
| Name: | 3-Chlorophenyl isocyanate |
| Synonyms: | Benzene, 1-chloro-3-isocyanato-; 1-chloro-3-isocyanato-benzen; 3-Chloroisocyanatobenzene; 3-chlorophenylcarbonimide; benzene,1-chloro-3-isocyanato-; Isocyanic acid, m-chlorophenyl ester; isocyanicacid,m-chlorophenylester; m-Chlorfenylisokyanat; m-chlorophenylcarbonimide; 1-Chloro-3-isocyanato-benzene |
| CAS: | 2909-38-8 |
| EINECS: | 220-822-5 |
| Molecular Formula: | C7H4ClNO |
| Molecular Weight: | 153.57 |
| InChI: | InChI=1/C7H4ClNO/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2206 |
| Density: | 1.27 |
| Stability: | Stable under normal temperatures and pressures. Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5576-1.5596 |
| Water Solubility: | Decomposes |
| Solubility: | Decomposes in water |
| Appearance: | colorless limpid liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a cool, dry place. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
T+:Verytoxic
|
| |
 |
