| Identification | |
| Name: | 3-fluorophenyl isothiocyanate |
| Synonyms: | Isothiocyanicacid, m-fluorophenyl ester (7CI,8CI); 1-Fluoro-3-isothiocyanatobenzene;3-Fluorophenyl isothiocyanate; NSC 78432; m-Fluorophenyl isothiocyanate |
| CAS: | 404-72-8 |
| EINECS: | 206-967-7 |
| Molecular Formula: | C7H4FNS |
| Molecular Weight: | 153.178 |
| InChI: | InChI=1S/C7H4FNS/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.15 g/cm3 |
| Refractive index: | n20/D 1.62(lit.) |
| Appearance: | yellow liquid |
| Specification: | clear orange liquid Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | 0-6°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
T: Toxic
Xi: Irritant
Xn: Harmful
|
 |
|
