| Identification | |
| Name: | 4-Fluorophenyl isothiocyanate |
| Synonyms: | 4-Fluoroisothiocyanatobenzene |
| CAS: | 1544-68-9 |
| EINECS: | 216-280-4 |
| Molecular Formula: | C7H4FNS |
| Molecular Weight: | 153.18 |
| InChI: | InChI=1/C7H4FNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1759 |
| Density: | 1.15g/cm3 |
| Refractive index: | 1.6195-1.6215 |
| Appearance: | White crystalline power |
| Specification: | clear yellow liquid after melting Safety Statements:23-26-36/37-39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 39:Wear eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
