| Identification | |
| Name: | 4-Phenylazophenyl isothiocyanate |
| Synonyms: | 4-Isothiocyanatoazobenzene |
| CAS: | 7612-96-6 |
| EINECS: | -0 |
| Molecular Formula: | C13H9N3S |
| Molecular Weight: | 239.29 |
| InChI: | InChI=1/C13H9N3S/c17-10-14-11-6-8-13(9-7-11)16-15-12-4-2-1-3-5-12/h1-9H/b16-15+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 94 °C |
| Flash Point: | 211.3°C |
| Boiling Point: | 402.4°Cat760mmHg |
| Density: | 1.15g/cm3 |
| Refractive index: | 1.629 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | II |
| Flash Point: | 211.3°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
