| Identification | |
| Name: | 4-iodophenyl isothiocyanate |
| Synonyms: | 4-Iodoisothiocyanatobenzene |
| CAS: | 2059-76-9 |
| EINECS: | -0 |
| Molecular Formula: | C7H4INS |
| Molecular Weight: | 261.07 |
| InChI: | InChI=1/C7H4INS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.76 g/cm3 |
| Refractive index: | 1.672 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive/Lachrymatory |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
