| Identification | |
| Name: | D-Pyroglutamic acid |
| Synonyms: | (2R)-5-oxopyrrolidine-2-carboxylic acid;D-5-Pyrrolidone-2-carboxylic acid;5-oxo-D-proline;CPD-656;H-D-Pyr-OH;(R)-(+)-2-pyrrolidone-5-carboxylic acid;D- pGlu-OH; |
| CAS: | 4042-36-8 |
| EINECS: | 223-735-0 |
| Molecular Formula: | C5H7NO3 |
| Molecular Weight: | 129.11 |
| InChI: | InChI=1/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.38g/cm3 |
| Alpha: | 27.5 o (C=10,1N NAOH) |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | White crystals with lumps |
| Usage: | Serves as a building block in the synthesis of diphthamide |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
