| Identification |
| Name: | 4-Cyanophenyl isocyanate |
| Synonyms: | P-CYANOPHENYL ISOCYANATE; 4-ISOCYANATOBENZONITRILE; 4-isocyanato-benzonitril; 4-Cyanophenyl; 4-CYANOPHENYL ISOCYANATE 95%; Benzonitrile, 4-isocyanato- |
| CAS: | 40465-45-0 |
| EINECS: | 254-934-0 |
| Molecular Formula: | C8H4N2O |
| Molecular Weight: | 144.13 |
| InChI: | InChI=1/C8H4N2O/c9-5-7-1-3-8(4-2-7)10-6-11/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2206 |
| Flash Point: | 32 C |
| Boiling Point: | 260.1°Cat760mmHg |
| Density: | 1.09g/cm3 |
| Stability: | Stable under normal temperatures and pressures. May decompose on exposure to moist air or water. |
| Refractive index: | 1.562 |
| Water Solubility: | insoluble (dec) |
| Solubility: | insoluble in water |
| Appearance: | whit yellowish crystalline solid |
| Flash Point: | 32 C |
| Storage Temperature: | Keep refrigerated. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
