| Identification | |
| Name: | 4-methoxyphenyl isocyanate |
| Synonyms: | Isocyanicacid, p-methoxyphenyl ester (6CI,7CI,8CI); Anisole, p-isocyanato- (6CI);1-Isocyanato-4-methoxybenzene; 4-Anisyl isocyanate; 4-Isocyanatoanisole;4-Methoxyphenyl isocyanate; NSC 7321; p-Anisyl isocyanate; p-Methoxyphenylisocyanate |
| CAS: | 5416-93-3 |
| EINECS: | 226-513-1 |
| Molecular Formula: | C8H7NO2 |
| Molecular Weight: | 149.15 |
| InChI: | InChI=1/C8H7NO2/c1-11-8-4-2-7(3-5-8)9-6-10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2206 |
| Density: | 1.151 |
| Stability: | No data. |
| Refractive index: | 1.545-1.547 |
| Solubility: | Insoluble |
| Appearance: | Colorless or slight yellow liquid |
| Specification: |
Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances.Wash thoroughly after handling. Use only in a well ventilated area. Avoid contact with eyes, skin, and clothing. Keep container tightly closed. Avoid ingestion and inhalation. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
