| Identification | |
| Name: | Benzenemethanol,2-fluoro-4-methoxy- |
| Synonyms: | (2-Fluoro-4-methoxyphenyl)methanol;2-Fluoro-4-methoxybenzyl alcohol; |
| CAS: | 405-09-4 |
| Molecular Formula: | C8H9FO2 |
| Molecular Weight: | 156.15 |
| InChI: | InChI=1/C8H9FO2/c1-11-7-3-2-6(5-10)8(9)4-7/h2-4,10H,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 114.8°C |
| Boiling Point: | 232.7°C at 760 mmHg |
| Density: | 1.187g/cm3 |
| Refractive index: | 1.51 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 114.8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
