| Identification | |
| Name: | Benzenemethanol,4-chloro-2-fluoro- |
| Synonyms: | (4-Chloro-2-fluorophenyl)methanol;4-Chloro-2-fluorobenzyl alcohol |
| CAS: | 56456-49-6 |
| Molecular Formula: | C7H6 Cl F O |
| Molecular Weight: | 160.57 |
| InChI: | InChI=1/C7H6ClFO/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 91.4°C |
| Boiling Point: | 227.6°Cat760mmHg |
| Density: | 1.344g/cm3 |
| Refractive index: | 1.542 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 91.4°C |
| Safety Data | |
 |
|
