| Identification | |
| Name: | 2,5-Dimethoxyphenyl isothiocyanate |
| Synonyms: | - |
| CAS: | 40532-06-7 |
| EINECS: | -0 |
| Molecular Formula: | C9H9NO2S |
| Molecular Weight: | 195.23 |
| InChI: | InChI=1/C9H9NO2S/c1-11-7-3-4-9(12-2)8(5-7)10-6-13/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Melting Point: | 33-36 °C(lit.) |
| Flash Point: | 158.3°C |
| Boiling Point: | 175 °C10 mm Hg(lit.) |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.537 |
| Specification: | Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 158.3°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
