| Identification |
| Name: | Thiophene-2-glyoxylic acid |
| Synonyms: | 2-Thiopheneglyoxylic acid; 2-Thienylglyoxylic Acid |
| CAS: | 4075-59-6 |
| EINECS: | 223-794-2 |
| Molecular Formula: | C6H4O3S |
| Molecular Weight: | 156.15916 |
| InChI: | InChI=1S/C6H4O3S/c7-5(6(8)9)4-2-1-3-10-4/h1-3H,(H,8,9) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3261 |
| Density: | 1.486 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | yellow to greenish crystalline powder |
| Packinggroup: | III |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
