| Identification | |
| Name: | Glyoxylic acid |
| Synonyms: | Acetic acid, oxo-; Glyoxalate; glyoxylate |
| CAS: | 298-12-4 |
| EINECS: | 206-058-5 |
| Molecular Formula: | C2H2O3 |
| Molecular Weight: | 74.04 |
| InChI: | InChI=1/C2H2O3/c3-1-2(4)5/h1H,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 2 |
| Flash Point: | 103.9 oC |
| Density: | 1.3 |
| Refractive index: | 1.414-1.418 |
| Water Solubility: | miscible |
| Solubility: | miscible |
| Appearance: | Yellowish Transparent Liquid |
| Report: |
Reported in EPA TSCA Inventory |
| Packinggroup: | III |
| Flash Point: | 103.9 oC |
| Color: | Monoclinic crystals from water Rhombic prisms obtained from water with 1/2 mol of water of crystallization. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
