| Identification | |
| Name: | 1-(2,3-Dichlorophenyl)-piperazine |
| Synonyms: | 4-(2,3-Dichlorophenyl)piperazine;DCPP;N-(2,3-Dichlorophenyl)piperazine;Piperazine,1-(2,3-dichlorophenyl)-; |
| CAS: | 41202-77-1 |
| Molecular Formula: | C10H12Cl2N2 |
| Molecular Weight: | 267.5826 |
| InChI: | InChI=1S/C10H12Cl2N2/c11-8-2-1-3-9(10(8)12)14-6-4-13-5-7-14/h1-3,13H,4-7H2/p+1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 242-244 ºC |
| Flash Point: | 174.6 ºC |
| Boiling Point: | 365.1 ºC at 760 mmHg |
| Density: | 1.272 g/cm3 |
| Appearance: | Brown Oil |
| Specification: |
1-(2,3-Dichlorophenyl)-piperazine hydrochloride , with CAS number of 41202-77-1, can be called 1-(2,3-Dichlorophenyl)piperazine hydrochloride (1:1) ; 1-(2,3-Dichlorphenyl)piperazinhydrochlorid ; piperazine, 1-(2,3-dichlorophenyl)-, hydrochloride (1:1) ; 1-(2,3-Dichlorophenyl)-Piperazine HCl . It is a kind of brown oil. |
| Flash Point: | 174.6 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
