| Identification | |
| Name: | 7-Methoxy-2-tetralone |
| Synonyms: | 7-Methoxy-1,2,3,4-tetrahydronaphthalen-2-one;7-methoxytetralin-2-one;7-Methoxy-3,4-dihydronaphthalen-2(1H)-one;7-methoxy-3,4-dihydronaphthalen-2-one; |
| CAS: | 4133-34-0 |
| EINECS: | 223-954-1 |
| Molecular Formula: | C11H12O2 |
| Molecular Weight: | 176.21178 |
| InChI: | InChI=1S/C11H12O2/c1-13-11-5-3-8-2-4-10(12)6-9(8)7-11/h3,5,7H,2,4,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Melting Point: | 27 - 28 |
| Density: | 1.13 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.559-1.563 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | yellow to brown semi-solid |
| Specification: | Clear yellow to orange liquid after melting Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Safety Data | |
| Hazard Symbols | |
 |
|
