Identification |
Name: | 7-Methoxy-2-tetralone |
Synonyms: | 7-Methoxy-1,2,3,4-tetrahydronaphthalen-2-one;7-methoxytetralin-2-one;7-Methoxy-3,4-dihydronaphthalen-2(1H)-one;7-methoxy-3,4-dihydronaphthalen-2-one; |
CAS: | 4133-34-0 |
EINECS: | 223-954-1 |
Molecular Formula: | C11H12O2 |
Molecular Weight: | 176.21178 |
InChI: | InChI=1S/C11H12O2/c1-13-11-5-3-8-2-4-10(12)6-9(8)7-11/h3,5,7H,2,4,6H2,1H3 |
Molecular Structure: |
|
Properties |
Transport: | 200kgs |
Melting Point: | 27 - 28 |
Density: | 1.13 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.559-1.563 |
Water Solubility: | Insoluble |
Solubility: | Insoluble |
Appearance: | yellow to brown semi-solid |
Specification: | Clear yellow to orange liquid after melting Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
Safety Data |
Hazard Symbols |
|
|
|