| Identification | |
| Name: | 2-Tetralone |
| Synonyms: | beta-Tetralone; 3,4-Dihydro-2,(1H)-naphtalenone; 1,2,3,4-Tetrahydro-2-naphthalenone; 3,4-dihydronaphthalen-2(1H)-one |
| CAS: | 530-93-8 |
| EINECS: | 208-498-3 |
| Molecular Formula: | C10H10O |
| Molecular Weight: | 146.19 |
| InChI: | InChI=1/C10H10O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4H,5-7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Flash Point: | > 110 C |
| Density: | 1.106 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.559-1.563 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble < |
| Appearance: | clear to yellow liquid |
| Packinggroup: | I; II; III |
| HS Code: | 29143900 |
| Flash Point: | > 110 C |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
