| Identification | |
| Name: | Alpha-Tetralone |
| CAS: | 529-34-0 |
| EINECS: | 208-460-6 |
| Molecular Formula: | C10H10O |
| Molecular Weight: | 146.18 |
| InChI: | InChI=1/C10H10O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6H,3,5,7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.096 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5675-1.5695 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble < |
| Appearance: | clear to yellow liquid |
| Packinggroup: | I; II; III |
| HS Code: | 29143900 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | brown |
| Usage: | Solvent and intermediate. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
