| Identification | |
| Name: | L-Cysteine, S-butyl- |
| Synonyms: | Alanine,3-(butylthio)-, L- (8CI);S-(n-Butyl)-L-cysteine;S-Butyl-L-cysteine;S-Butylcysteine; |
| CAS: | 4134-56-9 |
| Molecular Formula: | C7H15NO2S |
| Molecular Weight: | 177.2645 |
| InChI: | InChI=1/C7H15NO2S/c1-3-5(2)8-6(4-11)7(9)10/h5-6,8,11H,3-4H2,1-2H3,(H,9,10)/t5?,6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.092 g/cm3 |
| Refractive index: | 1.496 |
| Specification: |
The S-Butyl-D-cysteine, with the cas registry number 4134-56-9, has the systematic name of N-(1-methylpropyl)-L-cysteine. It belongs to the category of Amino Acids. And the molecular formula of the chemical is C7H15NO2S. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.88; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.62; (4)ACD/LogD (pH 7.4): -0.63; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 6; (12)Polar Surface Area: 54.84 Å2; (13)Index of Refraction: 1.496; (14)Molar Refractivity: 47.45 cm3; (15)Molar Volume: 162.3 cm3; (16)Polarizability: 18.81×10-24cm3; (17)Surface Tension: 39.5 dyne/cm; (18)Density: 1.092 g/cm3; (19)Flash Point: 115.6 °C; (20)Enthalpy of Vaporization: 55.65 kJ/mol; (21)Boiling Point: 267.6 °C at 760 mmHg; (22)Vapour Pressure: 0.00232 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
