Identification |
Name: | 3-Hexenoic acid |
Synonyms: | Hydrosorbicacid (6CI); NSC 26715; D3-Hexenoic acid |
CAS: | 4219-24-3 |
EINECS: | 224-157-1 |
Molecular Formula: | C6H10 O2 |
Molecular Weight: | 114.16 |
InChI: | InChI=1/C6H10O2/c1-2-3-4-5-6(7)8/h3-4H,2,5H2,1H3,(H,7,8) |
Molecular Structure: |
 |
Properties |
Flash Point: | 106.4°C |
Boiling Point: | 209°Cat760mmHg |
Density: | 0.985g/cm3 |
Refractive index: | 1.455 |
Specification: |
3-Hexenoic acid (CAS NO.4219-24-3) is also called 3-02-00-01321 (Beilstein Handbook Reference) ; BRN 1745294 ;
FEMA No. 3170 ; Hydrosorbic acid ; NSC 26715 .3-Hexenoic acid (CAS NO.4219-24-3) is clear colorless to light yellow liquid. Natural products exist in eggs, fruit and so on.
|
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 106.4°C |
Safety Data |
|
 |