| Identification | |
| Name: | Anthracene,9,10-dihydro-9,9-dimethyl- |
| Synonyms: | 9,10-Dihydro-9,9-dimethylanthracene;9,9-Dimethyl-9,10-dihydroanthracene; |
| CAS: | 42332-94-5 |
| Molecular Formula: | C16H16 |
| Molecular Weight: | 208.30 |
| InChI: | InChI=1/C16H16/c1-16(2)14-9-5-3-7-12(14)11-13-8-4-6-10-15(13)16/h3-10H,11H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 136 ºC |
| Boiling Point: | 298 ºC |
| Density: | 1.018 |
| Refractive index: | 1.576 |
| Solubility: | 298 ºC |
| Specification: |
The 9,10-Dihydro-9,9-dimethylanthracene , with the CAS register number 42332-94-5, is also known to us as 9,9-Dimethyl-9,10-dihydroanthracene . Properties of this kind of chemical are as followings: (1)Index of Refraction: 1.576 ; (2)Molar Refractivity: 67.72 cm3 ; (3)Molar Volume: 204.4 cm3 ; (4)Polarizability: 26.84 ×10-24cm3 ; (5)Surface Tension: 38.6 dyne/cm; (6)Density: 1.018 g/cm3 ; (7)Flash Point: 136.3 °C ; (8)Enthalpy of Vaporization: 51.61 kJ/mol ; (9)Boiling Point: 297.8 °C at 760 mmHg ; (10)Vapour Pressure: 0.00234 mmHg at 25°C. Besides, you could find the chemical molecular structure through converting the following data information: |
| Flash Point: | 136 ºC |
| Safety Data | |
 |
|
