| Identification | |
| Name: | b-Alanine, ethyl ester,hydrochloride (1:1) |
| CAS: | 4244-84-2 |
| EINECS: | 224-203-0 |
| Molecular Formula: | C5H11NO2.HCl |
| Molecular Weight: | 153.61 |
| InChI: | InChI=1/C5H11NO2.ClH/c1-2-8-5(7)3-4-6;/h2-4,6H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Stability: | No data. |
| Appearance: | White to off-white crystalline powder |
| Specification: | White to off-white crystalline powder Safety Statements:36/37/39-26-22-36 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 22:Do not breathe dust 36:Wear suitable protective clothing |
| HS Code: | 29224995 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
