| Identification | |
| Name: | 4-Pyridinecarbonylchloride, 2,6-dichloro- |
| Synonyms: | Isonicotinoylchloride, 2,6-dichloro- (6CI); 2,6-Dichloroisonicotinoyl chloride;2,6-Dichloropyridine-4-carbonyl chloride |
| CAS: | 42521-08-4 |
| Molecular Formula: | C6H2 Cl3 N O |
| Molecular Weight: | 210.44 |
| InChI: | InChI=1/C6H2Cl3NO/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Flash Point: | 110 oC |
| Density: | 1.537 |
| Refractive index: | 1.579 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 110 oC |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
