| Identification | |
| Name: | Acetamide,2-bromo-2-fluoro- |
| Synonyms: | 2-Bromo-2-fluoroacetamide;Bromofluoroacetamide |
| CAS: | 430-91-1 |
| Molecular Formula: | C2H3 Br F N O |
| Molecular Weight: | 155.95 |
| InChI: | InChI=1/C2H3BrFNO/c3-1(4)2(5)6/h1H,(H2,5,6) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 44 |
| Flash Point: | 107.5°C |
| Boiling Point: | 254.2°Cat760mmHg |
| Density: | 1.916g/cm3 |
| Refractive index: | 1.47 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 107.5°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
