Identification |
Name: | 1,3-Benzenedicarboxylicacid, 4-nitro- |
Synonyms: | Isophthalicacid, 4-nitro- (7CI,8CI); 1-Nitrobenzene-2,4-dicarboxylic acid;3-Carboxy-4-nitrobenzoic acid; 4-Nitrobenzene-1,3-dicarboxylic acid;4-Nitroisophthalic acid |
CAS: | 4315-09-7 |
Molecular Formula: | C8H5 N O6 |
Molecular Weight: | 211.13 |
InChI: | InChI=1/C8H5NO6/c10-7(11)4-1-2-6(9(14)15)5(3-4)8(12)13/h1-3H,(H,10,11)(H,12,13) |
Molecular Structure: |
 |
Properties |
Melting Point: | 258-259°C |
Flash Point: | 222.5°C |
Boiling Point: | 492.9°C at 760 mmHg |
Density: | 1.671g/cm3 |
Refractive index: | 1.66 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 222.5°C |
Safety Data |
|
 |