| Identification | |
| Name: | 1,3-Benzenedicarboxylicacid, 4-nitro- |
| Synonyms: | Isophthalicacid, 4-nitro- (7CI,8CI); 1-Nitrobenzene-2,4-dicarboxylic acid;3-Carboxy-4-nitrobenzoic acid; 4-Nitrobenzene-1,3-dicarboxylic acid;4-Nitroisophthalic acid |
| CAS: | 4315-09-7 |
| Molecular Formula: | C8H5 N O6 |
| Molecular Weight: | 211.13 |
| InChI: | InChI=1/C8H5NO6/c10-7(11)4-1-2-6(9(14)15)5(3-4)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 258-259°C |
| Flash Point: | 222.5°C |
| Boiling Point: | 492.9°C at 760 mmHg |
| Density: | 1.671g/cm3 |
| Refractive index: | 1.66 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 222.5°C |
| Safety Data | |
 |
|
