| Identification | |
| Name: | 1,4-Benzenedicarboxylicacid, 2-nitro- |
| Synonyms: | Terephthalicacid, nitro- (6CI,7CI,8CI); 2-Nitro-p-phthalic acid;2-Nitrobenzene-1,4-dicarboxylic acid; 2-Nitroterephthalic acid; NSC 48124; NSC75848; Nitroterephthalic acid |
| CAS: | 610-29-7 |
| EINECS: | 210-217-4 |
| Molecular Formula: | C8H5 N O6 |
| Molecular Weight: | 211.13 |
| InChI: | InChI=1/C8H5NO6/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h1-3H,(H,10,11)(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.671 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.66 |
| Solubility: | Very soluble |
| Appearance: | white to off-white powder |
| Specification: |
Nitroterephthalic acid , its cas register number is 610-29-7. It also can be called 2-Nitroterephthalic acid ; 5-Nitroterephthalic acid ; Terephthalic acid, nitro- ; 1,4-Benzenedicarboxylic acid, 2-nitro- .It is a white crystalline powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
