Identification |
Name: | AJMALICINE HYDROCHLORIDE |
Synonyms: | RAUBASINE HYDROCHLORIDE;ajmalicine,monohydrochloride;gamma-yohimbinehydrochloride;gamma-yohimbinhydrochloride;oxayohimban-16-carboxylicacid,16,17-didehydro-19-methyl-,methylester,mon;D-YOHIMBINE;DELTA-YOHIMBINE HYDROCHLORIDE;AJMALICINE HCL |
CAS: | 4373-34-6 |
EINECS: | 224-471-9 |
Molecular Formula: | C21H25ClN2O3 |
Molecular Weight: | 388.89 |
InChI: | InChI=1/C21H24N2O3.ClH/c1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2;/h3-6,11-12,15-16,19,22H,7-10H2,1-2H3;1H/t12-,15-,16+,19-;/m0./s1 |
Molecular Structure: |
 |
Properties |
Melting Point: | 275-300 °C |
Flash Point: | 270.7°C |
Boiling Point: | 524°C at 760 mmHg |
Density: | g/cm3 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 270.7°C |
Safety Data |
|
 |