| Identification | |
| Name: | Benzaldehyde,4-(phenylmethoxy)- |
| Synonyms: | Benzaldehyde,p-(benzyloxy)- (6CI,7CI,8CI);4-(Benzyloxy)benzaldehyde;4-(Phenylmethoxy)benzaldehyde;NSC 131669;NSC 28298;p-(Benzyloxy)benzaldehyde; |
| CAS: | 4397-53-9 |
| EINECS: | 224-527-2 |
| Molecular Formula: | C14H12O2 |
| Molecular Weight: | 212.24 |
| InChI: | InChI=1/C14H12O2/c15-10-12-6-8-14(9-7-12)16-11-13-4-2-1-3-5-13/h1-10H,11H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 197 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.607 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | Yellow to white crystals |
| Specification: |
4-Benzyloxybenzaldehyde (CAS NO.4397-53-9) is also called as 4-(Benzyloxy)benzaldehyde ; p-(Benzyloxy)benzaldehyde ; Benzaldehyde, 4-(phenylmethoxy)- ; Benzaldehyde, p-(benzyloxy)- (8CI) . |
| HS Code: | 29124900 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Sensitive: | Air Sensitive |
| Safety Data | |
 |
|
