| Identification | |
| Name: | 2-Furancarboxylic acid,3-methyl- |
| Synonyms: | 2-Furoicacid, 3-methyl- (6CI,7CI,8CI); 3-Methyl-2-furoic acid;3-Methylfuran-2-carboxylic acid; Elsholtzic acid; NSC 508742 |
| CAS: | 4412-96-8 |
| EINECS: | 224-571-2 |
| Molecular Formula: | C6H6 O3 |
| Molecular Weight: | 126.11 |
| InChI: | InChI=1/C6H6O3/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.248g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | White solid. |
| Specification: |
2-Furancarboxylic acid,3-methyl- , with CAS number of 4412-96-8, can be called 2-Furancarboxylic acid, 3-methyl- ; Timtec-bb sbb004257 ; 3-Methyl-2-furoic acid ; 3-Methylfuran-2-carboxylic acid ; 3-Methyl-2-furoic acid, 98+% ; Elsholtzic acid . 2-Furancarboxylic acid,3-methyl- (CAS NO.4412-96-8) is a white to beige powder. |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
