| Identification | |
| Name: | 2-Furancarboxylic acid,3-methyl-, methyl ester |
| Synonyms: | 2-Furoicacid, 3-methyl-, methyl ester (6CI,7CI,8CI); 3-Methylfuran-2-carboxylic acidmethyl ester; Methyl 3-methyl-2-furancarboxylate; Methyl 3-methyl-2-furoate;Methyl 3-methylfuroate; NSC 508754 |
| CAS: | 6141-57-7 |
| EINECS: | 228-131-0 |
| Molecular Formula: | C7H8 O3 |
| Molecular Weight: | 140.14 |
| InChI: | InChI=1/C7H8O3/c1-5-3-6(10-4-5)7(8)9-2/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 601 |
| Refractive index: | 1.468 |
| Specification: |
2-Furancarboxylic acid,3-methyl-, methyl ester , with CAS number of 6141-57-7, can be called 3-Methylfuran-2-carboxylic acid methyl ester ; Methyl 3-methyl-2-furoate ; Methyl3-methyl-2-furoate,98% ; 3-Methyl-2-furancarboxylic acid methyl ester . 2-Furancarboxylic acid,3-methyl-, methyl ester (CAS NO.6141-57-7) is a white crystalline low melting mass. |
| Safety Data | |
 |
|
