| Identification | |
| Name: | Phenol,2,2'-thiobis[4-chloro-6-methyl- |
| Synonyms: | o-Cresol,6,6'-thiobis[4-chloro- (6CI,7CI,8CI);2,2'-Dihydroxy-3,3'-dimethyl-5,5'-dichlorodiphenyl sulfide; 2,2'-Thiobis(4-chloro-6-methylphenol);Chlorbisan; Orbisan; Orbisan 1/3 |
| CAS: | 4418-66-0 |
| EINECS: | 224-582-2 |
| Molecular Formula: | C14H12 Cl2 O2 S |
| Molecular Weight: | 315.22 |
| InChI: | InChI=1/C14H12Cl2O2S/c1-7-3-9(15)5-11(17)13(7)19-14-8(2)4-10(16)6-12(14)18/h3-6,17-18H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.48 g/cm3 |
| Refractive index: | 1.692 |
| Specification: |
2,2'-Dihydroxy-3,3'-dimethyl-5,5'-dichlorodiphenyl sulfide ,its cas register number is 4418-66-0. It also can be called 6,6'-Thiobis(4-chloro-o-cresol) ;and 2,2'-Thiobis(4-chloro-6-methylphenol) . 2,2'-Dihydroxy-3,3'-dimethyl-5,5'-dichlorodiphenyl sulfide (CAS NO.4418-66-0) is highly toxic by ingestion, and is a halogenated organosulfide and phenol. Incompatible with acids, diazo and azo compounds, halocarbons, isocyanates, aldehydes, alkali metals, nitrides, hydrides, and other strong reducing agents. |
| Report: |
EPA Extremely Hazardous Substances List. Chlorophenol compounds are on the Community Right-To-Know List. |
| Safety Data | |
 |
|
