| Identification | |
| Name: | Phenol,2,2'-thiobis[4-chloro- |
| Synonyms: | 2,2'-Dihydroxy-5,5'-dichlorodiphenylsulfide;5,5'-Dichloro-2,2'-dihydroxydiphenyl sulfide;Bis(2-hydroxy-5-chlorophenyl) sulfide;CR 305;D 25;D 25-Antimykotikum;Fentichlor;Fenticlor;HL 1050;Meflorin;NSC 4112;NSC 55636;Novex;Oksid;Ovitrol;Ph 549;S 7;S 7 (antimycotic); |
| CAS: | 97-24-5 |
| EINECS: | 202-568-7 |
| Molecular Formula: | C12H8Cl2O2S |
| Molecular Weight: | 287.1617 |
| InChI: | InChI=1/C12H8Cl2O2S/c13-7-1-3-9(15)11(5-7)17-12-6-8(14)2-4-10(12)16/h1-6,15-16H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.58 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.73 |
| Water Solubility: | negligible in water |
| Solubility: | negligible in water |
| Appearance: | white to pale yellow powder |
| Specification: | white to pale yellow powder Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
