| Identification | |
| Name: | chloroacetyl isocyanate |
| Synonyms: | 2-Chloroacetyl isocyanate;Acetyl isocyanate, chloro-;Chloroacetyl isocyante;chloro-acetylisocyanat;CHLOROACETYL ISOCYANATE;Chloroacetyl isocyanate, tech., 90%;Chloroacetyl isocyanate, 90%, tech |
| CAS: | 4461-30-7 |
| EINECS: | 224-715-4 |
| Molecular Formula: | C3H2ClNO2 |
| Molecular Weight: | 119.5062 |
| InChI: | InChI=1S/C3H2ClNO2/c4-1-3(7)5-2-6/h1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3080 |
| Flash Point: | 61 °C |
| Boiling Point: | 50-55 °C (20 mmHg) |
| Density: | 1.403 |
| Refractive index: | 1.4630 |
| Specification: | CLEAR YELLOW LIQUID Safety Statements:8-45-36/37/39-26 8:Keep container dry 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| Flash Point: | 61 °C |
| Storage Temperature: | -20°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
