Identification |
Name: | 244-54-2 |
Synonyms: | DIPHENYLENEIODONIUM SULFATE;DPI SULFATE;bis(dibenziodonium) sulphate |
CAS: | 4510-83-2 |
EINECS: | 224-829-4 |
Molecular Formula: | C12H8I+ |
Molecular Weight: | 654.26 |
InChI: | InChI=1/C12H8I/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H/q+1 |
Molecular Structure: |
 |
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | g/cm3 |
Specification: | Pale Yellow Solid usageEng:Binds strongly to flavoproteins and is thus inhibits NO synthase, NADG reductase and NADPH oxidase |
Flash Point: | °C |
Usage: | Binds strongly to flavoproteins and is thus inhibits NO synthase, NADG reductase and NADPH oxidase |
Safety Data |
|
 |