| Identification | |
| Name: | 244-54-2 |
| Synonyms: | DIPHENYLENEIODONIUM SULFATE;DPI SULFATE;bis(dibenziodonium) sulphate |
| CAS: | 4510-83-2 |
| EINECS: | 224-829-4 |
| Molecular Formula: | C12H8I+ |
| Molecular Weight: | 654.26 |
| InChI: | InChI=1/C12H8I/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H/q+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: | Pale Yellow Solid usageEng:Binds strongly to flavoproteins and is thus inhibits NO synthase, NADG reductase and NADPH oxidase |
| Flash Point: | °C |
| Usage: | Binds strongly to flavoproteins and is thus inhibits NO synthase, NADG reductase and NADPH oxidase |
| Safety Data | |
 |
|
