Identification |
Name: | Benzene,1-(chloromethyl)-2,4-difluoro- |
Synonyms: | Toluene, a-chloro-2,4-difluoro-(6CI,7CI,8CI);1-(Chloromethyl)-2,4-difluorobenzene;2,4-Difluorobenzylchloride;alpha-Chloro-2,4-difluorotoluene; |
CAS: | 452-07-3 |
Molecular Formula: | C7H5ClF2 |
Molecular Weight: | 162.56 |
InChI: | InChI=1/C7H5ClF2/c8-4-5-1-2-6(9)3-7(5)10/h1-3H,4H2 |
Molecular Structure: |
 |
Properties |
Transport: | 1760 |
Melting Point: | 0°C |
Density: | 1.294 |
Refractive index: | 1.4910 |
Solubility: | insoluble in water |
Appearance: | liquid |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Packinggroup: | III |
Sensitive: | Lachrymatory |
Safety Data |
Hazard Symbols |
C: Corrosive
Xi: Irritant
|
|
 |