Identification |
Name: | Benzene,2-(chloromethyl)-1,4-difluoro- |
Synonyms: | Toluene, a-chloro-2,5-difluoro-(6CI,7CI,8CI); 2,5-Difluorobenzyl chloride;2-(Chloromethyl)-1,4-difluorobenzene |
CAS: | 495-07-8 |
Molecular Formula: | C7H5 Cl F2 |
Molecular Weight: | 162.56 |
InChI: | InChI=1/C7H5ClF2/c8-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN1760 |
Flash Point: | 61.3°C |
Boiling Point: | 173.5°Cat760mmHg |
Density: | 1.294g/cm3 |
Refractive index: | 1.485 |
Specification: | Clear colorless liquid Safety Statements:45-36/37/39-26 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
Packinggroup: | III |
Flash Point: | 61.3°C |
Sensitive: | Lachrymatory |
Safety Data |
Hazard Symbols |
C: Corrosive
Xi: Irritant
|
|
 |