| Identification |
| Name: | 3-Fluoro-4-methylaniline |
| Synonyms: | p-Toluidine,3-fluoro- (6CI,7CI,8CI); (3-Fluoro-4-methylphenyl)amine;2-Fluoro-4-aminotoluene; 3-Fluoro-4-methylaniline; 3-Fluoro-p-toluidine;4-Amino-2-fluorotoluene; NSC 57470 |
| CAS: | 452-77-7 |
| EINECS: | 207-212-4 |
| Molecular Formula: | C7H8FN |
| Molecular Weight: | 125.14 |
| InChI: | InChI=1/C7H8FN/c1-5-2-3-6(9)4-7(5)8/h2-4H,9H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Density: | 1.093 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5385-1.5405 |
| Appearance: | colorless or slight yellow solid |
| Packinggroup: | I |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
