| Identification | |
| Name: | 2-Fluoro-4-methylaniline |
| Synonyms: | 2-fluoro-4-methyl-benzenamin; 2-fluoro-p-toluidin; 4-AMINO-3-FLUOROTOLUENE; 2-FLUORO-P-TOLUIDINE; TIMTEC-BB SBB006650; NH2=1; 2-Fluoro-4-methylaniline 99% |
| CAS: | 452-80-2 |
| EINECS: | 259-564-3 |
| Molecular Formula: | C7H8FN |
| Molecular Weight: | 125.14 |
| InChI: | InChI=1/C7H8FN/c1-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.108 |
| Stability: | No data. |
| Refractive index: | 1.532-1.534 |
| Appearance: | Pale orange liquid. |
| Specification: | clear orange to orange-brown liquid Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
