| Identification | |
| Name: | pyridine-2,4-diyldiamine |
| Synonyms: | 2,4-Diaminopyridine |
| CAS: | 461-88-1 |
| Molecular Formula: | C5H7N3 |
| Molecular Weight: | 109.13 |
| InChI: | InChI=1/C5H7N3/c6-4-1-2-8-5(7)3-4/h1-3H,(H4,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 197.6°C |
| Boiling Point: | 358°Cat760mmHg |
| Density: | 1.251g/cm3 |
| Refractive index: | 1.676 |
| Specification: |
2,4-Diaminopyridine , its cas register number is 461-88-1. It also can be called Pyridine-2,4-diamine ; and 2,4-Pyridinediamine . Its classification code is Drug / Therapeutic Agent. |
| Flash Point: | 197.6°C |
| Safety Data | |
 |
|
