| Identification | |
| Name: | Boronic acid,B,B'-1,4-phenylenebis- |
| Synonyms: | Boronicacid, 1,4-phenylenebis- (9CI);p-Benzenediboronic acid (6CI,7CI,8CI);1,4-Phenylenediboronic acid;Benzene-1,4-diboronic acid;NSC 25410;p-Phenylenebis(boric acid);p-Phenylenediboronic acid; |
| CAS: | 4612-26-4 |
| Molecular Formula: | C6H8B2O4 |
| Molecular Weight: | 165.74732 |
| InChI: | InChI=1S/C6H8B2O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4,9-12H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.33 g/cm3 |
| Refractive index: | 1.555 |
| Water Solubility: | ~2.5% (Water Solubility) |
| Solubility: | ~2.5% (Water Solubility) |
| Appearance: | White to off-white crystalline solid, essentially no odor. |
| Specification: | off-white powder usageEng:suzuki reaction Safety Statements:36-26 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29310095 |
| Storage Temperature: | 0-6°C |
| Usage: | suzuki reaction |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
